Systematic / IUPAC Name: 2-Butoxyethyl acetate
ID: Reference612
Other Names:
Butylglycol acetate;
Butylcellosolve acetate;
2-Butyloxyethyl acetate;
1-Acetoxy-2-butoxyethane;
Acetic acid 2-butoxyethyl ester
; more
Formula: C8H16O3
Class: Industrial Chemicals
2-Butoxyethyl acetate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 71 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/12/2015 9:32:11 AM |
| InChI | InChI=1S/C8H16O3/c1-3-4-5-10-6-7-11-8(2)9/h3-7H2,1-2H3 |
| InChI Key | NQBXSWAWVZHKBZ-UHFFFAOYSA-N |
| Canonical SMILES | CCCCOCCOC(=O)C |
| CAS | 112072 |
| Splash | |
| Other Names |
Butylglycol acetate; Butylcellosolve acetate; 2-Butyloxyethyl acetate; 1-Acetoxy-2-butoxyethane; Acetic acid 2-butoxyethyl ester; Ethanol, 2-butoxy-, acetate; n-Butoxyethanol acetate; 2-Butoxyethanol acetate; Ethanol, 2-butoxy-, 1-acetate |
| ChEMBL | CHEMBL2141776 |
| PubChem | 8160 |
| ChemIDPlus | 000112072 |
| Wikipedia | 2-Butoxyethylacetat (DE) |
| ChemSpider | 7868 |