Systematic / IUPAC Name: N-[3-(Methylsulfanyl)phenyl]-N'-(phenylsulfonyl)hydrazinecarboximidamide
ID: Reference6122
Other Names: Hydrazinecarboximidamide, N-[3-(methylthio)phenyl]-N'-(phenylsulfonyl)-
Formula: C14H16N4O2S2
N1-Hydrazino[3-(methylthio)anilino]methylidenebenzene-1-sulfonamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/29/2016 7:13:22 AM |
| InChI | InChI=1S/C14H16N4O2S2/c1-21-12-7-5-6-11(10-12)16-14(17-15)18-22(19,20)13-8-3-2-4-9-13/h2-10H,15H2,1H3,(H2,16,17,18) |
| InChI Key | DCLASPXQWRYGQK-UHFFFAOYSA-N |
| Canonical SMILES | CSC1=CC=CC(=C1)NC(=NS(=O)(=O)C2=CC=CC=C2)NN |
| CAS | |
| Splash | |
| Other Names | Hydrazinecarboximidamide, N-[3-(methylthio)phenyl]-N'-(phenylsulfonyl)- |
| ChEMBL | CHEMBL1732198 |
| PubChem | 2824555; 5839623 |
| ChemSpider | 2102738 |