Systematic / IUPAC Name: 1-Benzyl-N-(2-nitrophenyl)-4-piperidinamine
ID: Reference6125
Other Names:
1-Benzyl-N-(2-nitrophenyl)piperidin-4-amine;
4-Piperidinamine, N-(2-nitrophenyl)-1-(phenylmethyl)-
Formula: C18H21N3O2
N4-(2-Nitrophenyl)-1-benzylpiperidin-4-amine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/29/2016 6:41:58 AM |
| InChI | InChI=1S/C18H21N3O2/c22-21(23)18-9-5-4-8-17(18)19-16-10-12-20(13-11-16)14-15-6-2-1-3-7-15/h1-9,16,19H,10-14H2 |
| InChI Key | YZKQBUWNKRTZQC-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | 7255892 |
| Splash | |
| Other Names |
1-Benzyl-N-(2-nitrophenyl)piperidin-4-amine; 4-Piperidinamine, N-(2-nitrophenyl)-1-(phenylmethyl)- |
| ChEMBL | CHEMBL1376379 |
| PubChem | 81675 |
| ChemSpider | 73698 |
| ChemIDPlus | 007255892 |