Systematic / IUPAC Name: 6,8-Dimethyl-8,9-didehydroergoline
ID: Reference6157
Other Names:
Agroclavin;
Indolo[4,3-fg]quinoline, 4,6,6a,7,8,10a-hexahydro-7, 9-dimethyl-
Formula: C16H18N2
Class: Natural Toxins
Agroclavine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 3457 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | IT; FT |
| Last Modification | 12/12/2016 7:10:19 AM |
| InChI | InChI=1S/C16H18N2/c1-10-6-13-12-4-3-5-14-16(12)11(8-17-14)7-15(13)18(2)9-10/h3-6,8,13,15,17H,7,9H2,1-2H3 |
| InChI Key | XJOOMMHNYOJWCZ-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC2C(CC3=CNC4=CC=CC2=C34)N(C1)C |
| CAS | |
| Splash | |
| Other Names |
Agroclavin; Indolo[4,3-fg]quinoline, 4,6,6a,7,8,10a-hexahydro-7, 9-dimethyl- |
| ChEMBL | CHEMBL1999620 |
| PubChem | 287403 |
| ChemSpider | 253418 |
| Wikipedia | Agroclavine |