Systematic / IUPAC Name: Ethyl {4-oxo-4-[(2-phenylethyl)amino]butyl}carbamate
ID: Reference6161
Other Names:
Santacruzamate A ;
N-{4-Oxo-4-[(2-phenylethyl)amino]butyl}-carbamic acid ethyl ester ;
Ethyl [4-oxo-4-(phenethylamino)butyl]carbamate ;
Ethyl N-[4-oxo-4-(2-phenylethylamino)butyl]carbamate
Formula: C15H22N2O3
CAY10683 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1542 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | IT; FT |
| Last Modification | 12/12/2016 10:02:41 AM |
| InChI | InChI=1S/C15H22N2O3/c1-2-20-15(19)17-11-6-9-14(18)16-12-10-13-7-4-3-5-8-13/h3-5,7-8H,2,6,9-12H2,1H3,(H,16,18)(H,17,19) |
| InChI Key | HTOYBIILVCHURC-UHFFFAOYSA-N |
| Canonical SMILES | CCOC(=O)NCCCC(=O)NCCC1=CC=CC=C1 |
| CAS | 1477949420 |
| Splash | |
| Other Names |
Santacruzamate A ; N-{4-Oxo-4-[(2-phenylethyl)amino]butyl}-carbamic acid ethyl ester ; Ethyl [4-oxo-4-(phenethylamino)butyl]carbamate ; Ethyl N-[4-oxo-4-(2-phenylethylamino)butyl]carbamate |
| PubChem | 72946782 |
| ChemSpider | 30771263 |
| ChEMBL | CHEMBL3086767 |