Systematic / IUPAC Name: (1R)-1,6,6-Trimethyl-1,2,6,7,8,9-hexahydrophenanthro[1,2-b]furan-10,11-dione
ID: Reference6164
Other Names:
(-)-Cryptotanshinone;
Cryptotanshinon;
Tanshinone C;
(R)-1,2,6,7,8,9-Hexahydro-1,6,6-trimethylphenanthro[1,2-b]furan-10,11-dione;
(R)-1,6,6-Trimethyl-1,2,6,7,8,9-hexahydrophenanthro[1,2-b]furan-10,11-dione
; more
Formula: C19H20O3
Class: Endogenous Metabolites Natural Products/Medicines
Cryptotanshinone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 4543 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | IT; FT |
| Last Modification | 12/13/2016 9:45:19 AM |
| InChI | InChI=1S/C19H20O3/c1-10-9-22-18-12-6-7-13-11(5-4-8-19(13,2)3)15(12)17(21)16(20)14(10)18/h6-7,10H,4-5,8-9H2,1-3H3/t10-/m0/s1 |
| InChI Key | GVKKJJOMQCNPGB-JTQLQIEISA-N |
| Canonical SMILES | CC1COC2=C1C(=O)C(=O)C3=C2C=CC4=C3CCCC4(C)C |
| CAS | 35825571 |
| Splash | |
| Other Names |
(-)-Cryptotanshinone; Cryptotanshinon; Tanshinone C; (R)-1,2,6,7,8,9-Hexahydro-1,6,6-trimethylphenanthro[1,2-b]furan-10,11-dione; (R)-1,6,6-Trimethyl-1,2,6,7,8,9-hexahydrophenanthro[1,2-b]furan-10,11-dione; (1R)-1,6,6-Trimethyl-2,7,8,9-tetrahydro-1H-naphtho[1,2-g]benzofuran-10,11-quinone; 1,2,6,7,8,9-Hexahydro-1,6,6-trimethyl-(R)-phenanthro[1,2-b]furan-10,11-dione ; Phenanthro[1,2-b]furan-10,11-dione, 1,2,6,7,8,9-hexahydro-1,6,6-trimethyl-, (R)- |
| PubChem | 160254 |
| ChEMBL | CHEMBL187460 |
| ChemSpider | 140851 |
| ChemIDPlus | 035825571 |