Systematic / IUPAC Name: (1Z,4Z)-N-Ethyl-4-[{4-[ethyl(3-sulfobenzyl)amino]phenyl}(2-sulfophenyl)methylene]-N-(3-sulfobenzyl)-2,5-cyclohexadien-1-iminium
ID: Reference6201
Other Names:
11388 Blue;
1206 Blue;
Acid blue 9;
Eriosky blue
Formula: C37H37N2O9S3 +
Class: Excipients/Additives/Colorants Personal Care Products/Cosmetics
Brilliant blue FCF mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 5870 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | IT; FT |
| Last Modification | 1/11/2017 10:56:05 AM |
| InChI | InChI=1S/C37H36N2O9S3/c1-3-38(25-27-9-7-11-33(23-27)49(40,41)42)31-19-15-29(16-20-31)37(35-13-5-6-14-36(35)51(46,47)48)30-17-21-32(22-18-30)39(4-2)26-28-10-8-12-34(24-28)50(43,44)45/h5-24H,3-4,25-26H2,1-2H3,(H2-,40,41,42,43,44,45,46,47,48)/p+1 |
| InChI Key | CTRXDTYTAAKVSM-UHFFFAOYSA-O |
| Canonical SMILES | CCN(CC1=CC(=CC=C1)S(=O)(=O)O)C2=CC=C(C=C2)C(=C3C=CC(=[N+](CC)CC4=CC(=CC=C4)S(=O)(=O)O)C=C3)C5=CC=CC=C5S(=O)(=O)O |
| CAS | |
| Splash | |
| Other Names |
11388 Blue; 1206 Blue; Acid blue 9; Eriosky blue |
| PubChem | 17560 |
| Wikipedia | Brilliant Blue FCF |
| ChemIDPlus | 003844459; 015792673; 025305786; 071701183; 071701194 |
| ChEMBL | CHEMBL3305988 |
| ChemSpider | 16603 |