Systematic / IUPAC Name: D-Xylopyranose
ID: Reference6209
Other Names:
(3R,4S,5R)-Oxane-2,3,4,5-tetrol;
(3R,4S,5R)-Tetrahydro-2H-pyran-2,3,4,5-tetraol;
(3R,4S,5R)-Tetrahydro-2H-pyran-2,3,4,5-tetrol;
D-Xyl;
D-Xylose
; more
Formula: C5H10O5
Class: Endogenous Metabolites
D-(+)-Xylose mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 422 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 8/4/2025 10:20:12 AM |
| InChI | InChI=1S/C5H10O5/c6-2-1-10-5(9)4(8)3(2)7/h2-9H,1H2/t2-,3+,4-,5?/m1/s1 |
| InChI Key | SRBFZHDQGSBBOR-IOVATXLUSA-N |
| Canonical SMILES | C1C(C(C(C(O1)O)O)O)O |
| CAS | 58866 |
| Splash | |
| Other Names |
(3R,4S,5R)-Oxane-2,3,4,5-tetrol; (3R,4S,5R)-Tetrahydro-2H-pyran-2,3,4,5-tetraol; (3R,4S,5R)-Tetrahydro-2H-pyran-2,3,4,5-tetrol; D-Xyl; D-Xylose; Wood sugar; Xylomed; Xylopyranose; Xylose; Xyloside |
| ChEBI | CHEBI:53455 |
| ChEMBL | CHEMBL502135 |
| ChemIDPlus | 050855328 |
| KEGG | C00181; D06346 |
| Wikipedia | Xylose |
| HMDb | HMDB00098 |
| PubChem | 135191 |
| ChemSpider | 119104; 26575594 |