Systematic / IUPAC Name: D-Ribofuranose
ID: Reference6211
Other Names:
(3R,4S,5R)-5-(Hydroxymethyl)tetrahydro-2,3,4-furantriol ;
Ribofuranose ;
D-Ribo-2,3,4,5-tetrahydroxyvaleraldehyde ;
(3R,4S,5R)-5-(Hydroxymethyl)tetrahydrofuran-2,3,4-triol ;
(3R,4S,5R)-5-(Hydroxymethyl)oxolane-2,3,4-triol
; more
Formula: C5H10O5
Class: Endogenous Metabolites
D-(-)-Ribose mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 94 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/20/2025 4:27:12 PM |
| InChI | InChI=1S/C5H10O5/c6-1-2-3(7)4(8)5(9)10-2/h2-9H,1H2/t2-,3-,4-,5?/m1/s1 |
| InChI Key | HMFHBZSHGGEWLO-SOOFDHNKSA-N |
| Canonical SMILES | C(C1C(C(C(O1)O)O)O)O |
| CAS | 50691 |
| Splash | |
| Other Names |
(3R,4S,5R)-5-(Hydroxymethyl)tetrahydro-2,3,4-furantriol ; Ribofuranose ; D-Ribo-2,3,4,5-tetrahydroxyvaleraldehyde ; (3R,4S,5R)-5-(Hydroxymethyl)tetrahydrofuran-2,3,4-triol ; (3R,4S,5R)-5-(Hydroxymethyl)oxolane-2,3,4-triol ; δ-(-)-Ribose ; D-Ribose |
| KEGG | C00121 |
| PubChem | 5779 |
| HMDb | HMDB00283 |
| Wikipedia | Ribose |
| ChemIDPlus | 000050691 |
| ChEBI | CHEBI:47013 |
| ChemSpider | 5575 |
| ChEMBL | CHEMBL444125 |