Systematic / IUPAC Name: (2R,3S,5S,6S)-2,3,4,5,6-Pentahydroxycyclohexyl 2-amino-4-{(Z)-[amino(carboxy)methylene]amino}-2,3,4,6-tetradeoxy-α-D-arabino-hexopyranoside
ID: Reference6223
Other Names:
{N'-[(2R,3S,5S,6R)-5-Amino-2-methyl-6-{[(2R,3S,5S,6S)-2,3,4,5,6-pentahydroxycyclohexyl]oxy}oxan-3-yl]carbamimidoyl}formic acid ;
D-chiro-Inositol, 3-O-{2-amino-4-[(carboxyiminomethyl)amino]-2,3,4,6-tetradeoxy-α-D-arabino-hexopyranosyl}-
Formula: C14H25N3O9
Class: Endogenous Metabolites
Kasugamycin mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1426 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | IT; FT |
| Last Modification | 1/18/2017 8:52:07 AM |
| InChI | InChI=1S/C14H25N3O9/c1-3-5(17-12(16)13(23)24)2-4(15)14(25-3)26-11-9(21)7(19)6(18)8(20)10(11)22/h3-11,14,18-22H,2,15H2,1H3,(H2,16,17)(H,23,24)/t3-,4+,5+,6?,7+,8+,9-,10+,11?,14-/m1/s1 |
| InChI Key | PVTHJAPFENJVNC-UQTMRZPGSA-N |
| Canonical SMILES | CC1C(CC(C(O1)OC2C(C(C(C(C2O)O)O)O)O)N)N=C(C(=O)O)N |
| CAS | |
| Splash | |
| Other Names |
{N'-[(2R,3S,5S,6R)-5-Amino-2-methyl-6-{[(2R,3S,5S,6S)-2,3,4,5,6-pentahydroxycyclohexyl]oxy}oxan-3-yl]carbamimidoyl}formic acid ; D-chiro-Inositol, 3-O-{2-amino-4-[(carboxyiminomethyl)amino]-2,3,4,6-tetradeoxy-α-D-arabino-hexopyranosyl}- |
| ChemIDPlus | 006980183 |
| ChemSpider | 58676 |
| PubChem | 65174 |
| Wikipedia | Kasugamycin |