Systematic / IUPAC Name: Quinolino[2',3':3,4]pyrrolo[2,1-b]quinazolin-11(13H)-one
ID: Reference6227
Other Names: Quino[2',3':3,4]pyrrolo[2,1-b]quinazolin-11(13H)-one
Formula: C18H11N3O
Class: Endogenous Metabolites
Luotonin A mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 254 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | IT; FT |
| Last Modification | 1/19/2017 7:35:25 AM |
| InChI | InChI=1S/C18H11N3O/c22-18-13-6-2-4-8-15(13)20-17-16-12(10-21(17)18)9-11-5-1-3-7-14(11)19-16/h1-9H,10H2 |
| InChI Key | LUMDXNLBIYLTER-UHFFFAOYSA-N |
| Canonical SMILES | C1C2=CC3=CC=CC=C3N=C2C4=NC5=CC=CC=C5C(=O)N41 |
| CAS | 205989124 |
| Splash | |
| Other Names | Quino[2',3':3,4]pyrrolo[2,1-b]quinazolin-11(13H)-one |
| ChEMBL | CHEMBL19163 |
| PubChem | 10334120 |
| ChemSpider | 8509579 |