Systematic / IUPAC Name: (1S,3aS,3bR,10aR,10bS,12aS)-10a,12a-Dimethyl-1,2,3,3a,3b,4,5,7,10,10a,10b,11,12,12a-tetradecahydrocyclopenta[5,6]naphtho[1,2-f]indazol-1-ol
ID: Reference6265
Other Names:
Cyclopenta[5,6]naphth[1,2-f]indazol-1-ol, 1,2,3,3a,3b,4,5,7,10,10a,10b,11,12,12a-tetradecahydro-10a,12a-dimethyl-, (1S,3aS,3bR,10aR,10bS,12aS)-;
(17β)-2'H-androsta-2,4-dieno[3,2-c]pyrazol-17-ol
Formula: C20H28N2O
Class: Drugs of Abuse/Illegal Drugs Sports Doping Drugs
[3,2-c]Pyrazole-androst-4-en-17β-ol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 99 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/14/2017 11:07:58 AM |
| InChI | InChI=1S/C20H28N2O/c1-19-8-7-16-14(15(19)5-6-18(19)23)4-3-13-9-17-12(11-21-22-17)10-20(13,16)2/h9,11,14-16,18,23H,3-8,10H2,1-2H3,(H,21,22)/t14-,15-,16-,18-,19-,20-/m0/s1 |
| InChI Key | TZVXVVYNTVBMQS-GJCUDGATSA-N |
| Canonical SMILES | [H][C@]12[C@@]([C@@](CC[C@@H]3O)([H])[C@]3(C)CC2)([H])CCC4=CC5=C(C=NN5)C[C@@]41C |
| CAS | 929042397 |
| Splash | |
| Other Names |
Cyclopenta[5,6]naphth[1,2-f]indazol-1-ol, 1,2,3,3a,3b,4,5,7,10,10a,10b,11,12,12a-tetradecahydro-10a,12a-dimethyl-, (1S,3aS,3bR,10aR,10bS,12aS)-; (17β)-2'H-androsta-2,4-dieno[3,2-c]pyrazol-17-ol |
| ChemSpider | 35519206 |