Systematic / IUPAC Name: 4-(2-Methylpropyl)benzoic acid
ID: Reference627
Other Names:
4-Isobutylbenzoic acid;
Benzoic acid, 4-(2-methylpropyl)-;
Benzoic acid, p-isobutyl-;
p-Isobutylbenzoic acid
Formula: C11H14O2
4-Isobutylbenzoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 71 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/13/2015 10:49:20 AM |
| InChI | InChI=1S/C11H14O2/c1-8(2)7-9-3-5-10(6-4-9)11(12)13/h3-6,8H,7H2,1-2H3,(H,12,13) |
| InChI Key | VUBBCFWWSKOHTH-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | 38861880 |
| Splash | |
| Other Names |
4-Isobutylbenzoic acid; Benzoic acid, 4-(2-methylpropyl)-; Benzoic acid, p-isobutyl-; p-Isobutylbenzoic acid |