Systematic / IUPAC Name: (5α,17β)-1-Methyl-3-oxoandrost-1-en-17-yl heptanoate
ID: Reference6279
Other Names:
Delapromor;
Menthenolone enanthate;
Metenolone enantate;
Methanolone enanthate;
Methenolone enanthate
; more
Formula: C27H42O3
Class: Sports Doping Drugs
Primobolan mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 102 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/16/2017 11:07:07 AM |
| InChI | InChI=1S/C27H42O3/c1-5-6-7-8-9-25(29)30-24-13-12-22-21-11-10-19-17-20(28)16-18(2)27(19,4)23(21)14-15-26(22,24)3/h16,19,21-24H,5-15,17H2,1-4H3/t19-,21-,22-,23-,24-,26-,27-/m0/s1 |
| InChI Key | TXUICONDJPYNPY-FRXWOFFRSA-N |
| Canonical SMILES | CCCCCCC(=O)OC1CCC2C1(CCC3C2CCC4C3(C(=CC(=O)C4)C)C)C |
| CAS | |
| Splash | |
| Other Names |
Delapromor; Menthenolone enanthate; Metenolone enantate; Methanolone enanthate; Methenolone enanthate; Primobolan-depot; [(5S,8R,9S,10S,13S,14S,17S)-1,10,13-Trimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] heptanoate; 17β-Hydroxy-1-methyl-5α-androst-1-en-3-one heptanoate; 5α-Androst-1-en-3-one, 17β-hydroxy-1-methyl-, heptanoate; Androst-1-en-3-one, 1-methyl-17-((1-oxoheptyl)oxy)-, (5α,17β)-; Androst-1-en-3-one, 1-methyl-17-[(1-oxoheptyl)oxy]-, (5a,17b)-; Heptanoic acid [(5S,8R,9S,10S,13S,14S,17S)-1,10,13-trimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] ester; Testosterone, 1-dehydro-4,5α-dihydro-1-methyl-, heptanoate; NSC 64967 ; SQ 16,374 |
| ChemSpider | 217360 |
| PubChem | 248271 |
| ChEMBL | CHEMBL2106949 |
| KEGG | D01301 |
| Wikipedia | Metenolone enanthate |