Systematic / IUPAC Name: Methyl 1-(2-phenylethyl)-4-[phenyl(propionyl)amino]-4-piperidinecarboxylate
ID: Reference6290
Other Names:
Carfentanila;
Carfentanilum;
Carfentanyl;
1-Phenethyl-4-(phenyl-propionyl-amino)-piperidine-4-carboxylic acid methyl ester;
4-[(1-Oxopropyl)phenylamino]-1-(2-phenylethyl)-4-piperidinecarboxylic acid methyl ester
; more
Formula: C24H30N2O3
Class: Drugs of Abuse/Illegal Drugs
Carfentanil mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/17/2017 12:46:52 PM |
| InChI | InChI=1S/C24H30N2O3/c1-3-22(27)26(21-12-8-5-9-13-21)24(23(28)29-2)15-18-25(19-16-24)17-14-20-10-6-4-7-11-20/h4-13H,3,14-19H2,1-2H3 |
| InChI Key | YDSDEBIZUNNPOB-UHFFFAOYSA-N |
| Canonical SMILES | CCC(=O)N(C1=CC=CC=C1)C2(CCN(CC2)CCC3=CC=CC=C3)C(=O)OC |
| CAS | 59708520 |
| Splash | |
| Other Names |
Carfentanila; Carfentanilum; Carfentanyl; 1-Phenethyl-4-(phenyl-propionyl-amino)-piperidine-4-carboxylic acid methyl ester; 4-[(1-Oxopropyl)phenylamino]-1-(2-phenylethyl)-4-piperidinecarboxylic acid methyl ester ; 4-Piperidinecarboxylic acid, 4[(1-oxopropyl)phenylamino]-1-(2-phenylethyl), methyl ester ; Carfentanil1-phenethyl-4-(phenyl-propionyl-amino)-piperidine-4-carboxylic acid methyl ester; Methyl 1-(2-phenylethyl)-4-[phenyl(propionyl)amino]piperidine-4-carboxylate; Methyl 1-phenethyl-4-(N-phenylpropionamido)isonipecotate; Methyl 1-phenylethyl-4-(N-phenylpropionamido)isonipecotate; Methyl 4-[N-(1-oxopropyl)-N-phenylamino]-1-(2-phenylethyl)-4-piperidinecarboxylate ; Methyl 4-(N-propionyl-N-phenylamino)-1-(2-phenylethyl)-4-piperidine-carboxylate; 4-Carbomethoxy fentanyl |
| DrugBank | DB01535 |
| ChEMBL | CHEMBL290429 |
| Wikipedia | Carfentanil |
| ChemIDPlus | 059708520 |
| ChEBI | CHEBI:61084 |
| PubChem | 62156 |
| ChemSpider | 55986 |
| KEGG | D07620 |