Systematic / IUPAC Name: (1-Propyl-1H-indol-3-yl)(4-propyl-1-naphthyl)methanone
ID: Reference6296
Other Names:
(1-Propyl-1H-indol-3-yl)(4-propylnaphthalen-1-yl)methanone;
Methanone, (1-propyl-1H-indol-3-yl)(4-propyl-1-naphthalenyl)-;
JWH 180
Formula: C25H25NO
Class: Drugs of Abuse/Illegal Drugs
JWH-180 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/20/2017 7:07:15 AM |
| InChI | InChI=1S/C25H25NO/c1-3-9-18-14-15-22(20-11-6-5-10-19(18)20)25(27)23-17-26(16-4-2)24-13-8-7-12-21(23)24/h5-8,10-15,17H,3-4,9,16H2,1-2H3 |
| InChI Key | BMOMWXXAVVSIRU-UHFFFAOYSA-N |
| Canonical SMILES | CCCC1=CC=C(C2=CC=CC=C12)C(=O)C3=CN(C4=CC=CC=C43)CCC |
| CAS | 824959877 |
| Splash | |
| Other Names |
(1-Propyl-1H-indol-3-yl)(4-propylnaphthalen-1-yl)methanone; Methanone, (1-propyl-1H-indol-3-yl)(4-propyl-1-naphthalenyl)-; JWH 180 |
| ChEMBL | CHEMBL539479 |
| PubChem | 45266978 |
| ChemSpider | 24611382 |