Systematic / IUPAC Name: N-(2-Ethoxyethyl)-1-phenylcyclohexan-1-amine
ID: Reference6299
Other Names:
N-(2-Ethoxyethyl)-1-phenylcyclohexanamine;
Cyclohexanamine, N-(2-ethoxyethyl)-1-phenyl-
Formula: C16H25NO
Class: Drugs of Abuse/Illegal Drugs
PCEEA mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 72 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/20/2017 9:24:08 AM |
| InChI | InChI=1S/C16H25NO/c1-2-18-14-13-17-16(11-7-4-8-12-16)15-9-5-3-6-10-15/h3,5-6,9-10,17H,2,4,7-8,11-14H2,1H3 |
| InChI Key | PRQVCBDFWYTXDD-UHFFFAOYSA-N |
| Canonical SMILES | CCOCCNC1(CCCCC1)C2=CC=CC=C2 |
| CAS | |
| Splash | |
| Other Names |
N-(2-Ethoxyethyl)-1-phenylcyclohexanamine; Cyclohexanamine, N-(2-ethoxyethyl)-1-phenyl- |