Systematic / IUPAC Name: [1-(5-Methylhexyl)-1H-indol-3-yl](2,2,3,3-tetramethylcyclopropyl)methanone
ID: Reference6301
Other Names: Methanone, [1-(5-methylhexyl)-1H-indol-3-yl](2,2,3,3-tetramethylcyclopropyl)-
Formula: C23H33NO
Class: Drugs of Abuse/Illegal Drugs
UR-144 N-(5-Methylhexyl) analog mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 87 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/20/2017 9:39:46 AM |
| InChI | InChI=1S/C23H33NO/c1-16(2)11-9-10-14-24-15-18(17-12-7-8-13-19(17)24)20(25)21-22(3,4)23(21,5)6/h7-8,12-13,15-16,21H,9-11,14H2,1-6H3 |
| InChI Key | JOVRITWYDROVAQ-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)CCCCN1C=C(C(C2C(C)(C)C2(C)C)=O)C3=C1C=CC=C3 |
| CAS | |
| Splash | |
| Other Names | Methanone, [1-(5-methylhexyl)-1H-indol-3-yl](2,2,3,3-tetramethylcyclopropyl)- |
| ChemSpider | 29341445 |