Systematic / IUPAC Name: 1-(3-Cyano-3,3-diphenylpropyl)-4-phenylpiperidine-4-carboxylic acid
ID: Reference6317
Other Names:
R-15403 ;
Difenoxilic acid;
Difenoxina;
Difenoxine;
Difenoxinum
; more
Formula: C28H28N2O2
Class: Drugs of Abuse/Illegal Drugs
Difenoxin mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 224 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/21/2017 11:51:42 AM |
| InChI | InChI=1S/C28H28N2O2/c29-22-28(24-12-6-2-7-13-24,25-14-8-3-9-15-25)18-21-30-19-16-27(17-20-30,26(31)32)23-10-4-1-5-11-23/h1-15H,16-21H2,(H,31,32) |
| InChI Key | UFIVBRCCIRTJTN-UHFFFAOYSA-N |
| Canonical SMILES | C1CN(CCC1(C2=CC=CC=C2)C(=O)O)CCC(C#N)(C3=CC=CC=C3)C4=CC=CC=C4 |
| CAS | |
| Splash | |
| Other Names |
R-15403 ; Difenoxilic acid; Difenoxina; Difenoxine; Difenoxinum; Difenoxylic acid; Diphenoxilic acid; Diphenoxin; Diphenoxylic acid; Lyspafen; 1-(3-Cyano-3,3-diphenylpropyl)-4-phenyl-4-piperidinecarboxylic acid; 1-(3-Cyano-3,3-diphenylpropyl)-4-phenylisonipecotic acid; 4-Piperidinecarboxylic acid, 1-(3-cyano-3,3-diphenylpropyl)-4-phenyl-; Isonipecotic acid, 1-(3-cyano-3,3-diphenylpropyl)-4-phenyl- |
| PubChem | 34328 |
| ChEMBL | CHEMBL1201321 |
| KEGG | C07871; D03809 |
| ChemIDPlus | 028782425 |
| DrugBank | DB01501 |
| ChEBI | CHEBI:4534 |
| ChemSpider | 31620 |
| Wikipedia | Difenoxin; Motofen |