Systematic / IUPAC Name: [(4R,4aR,7S,7aR,12bS)-7-Hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-E]isoquinoline-9-yl] acetate
ID: Reference6321
Other Names:
3-Monoacetylmorphine;
3-O-Acetylmorphine ;
Morphine, 3-acetate;
O(3)-Monoacetylmorphine ;
(5α,6α)-6-Hydroxy-17-methyl-7,8-didehydro-4,5-epoxymorphinan-3-yl acetate
Formula: C19H21NO4
Class: Drugs of Abuse/Illegal Drugs
3-Acetylmorphine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 92 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/21/2017 2:24:29 PM |
| InChI | InChI=1S/C19H21NO4/c1-10(21)23-15-6-3-11-9-13-12-4-5-14(22)18-19(12,7-8-20(13)2)16(11)17(15)24-18/h3-6,12-14,18,22H,7-9H2,1-2H3/t12-,13+,14-,18-,19-/m0/s1 |
| InChI Key | GMLREHXYJDLZOU-LEPYJNQMSA-N |
| Canonical SMILES | CC(=O)OC1=C2C3=C(CC4C5C3(CCN4C)C(O2)C(C=C5)O)C=C1 |
| CAS | 5140283 |
| Splash | |
| Other Names |
3-Monoacetylmorphine; 3-O-Acetylmorphine ; Morphine, 3-acetate; O(3)-Monoacetylmorphine ; (5α,6α)-6-Hydroxy-17-methyl-7,8-didehydro-4,5-epoxymorphinan-3-yl acetate; 3-MAM |
| PubChem | 5462504 |
| Wikipedia | 3-Monoacetylmorphine |
| ChemSpider | 4575431 |
| KEGG | C11778 |
| ChEBI | CHEBI:1445 |
| ChemIDPlus | 029593268 |