Systematic / IUPAC Name: N-(3-Methoxypropyl)-1-phenylcyclohexan-1-amine
ID: Reference6330
Other Names:
N-(3-Methoxypropyl)-1-phenylcyclohexanamine ;
Cyclohexanamine, N-(3-methoxypropyl)-1-phenyl
Formula: C16H25NO
Class: Drugs of Abuse/Illegal Drugs
PCMPA mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/22/2017 11:38:21 AM |
| InChI | InChI=1S/C16H25NO/c1-18-14-8-13-17-16(11-6-3-7-12-16)15-9-4-2-5-10-15/h2,4-5,9-10,17H,3,6-8,11-14H2,1H3 |
| InChI Key | OWOACIUDSBGLMN-UHFFFAOYSA-N |
| Canonical SMILES | COCCCNC1(CCCCC1)C2=CC=CC=C2 |
| CAS | |
| Splash | |
| Other Names |
N-(3-Methoxypropyl)-1-phenylcyclohexanamine ; Cyclohexanamine, N-(3-methoxypropyl)-1-phenyl |