Systematic / IUPAC Name: N'-[4-(3-Chloro-4-methylphenyl)-5-methyl-1,3-thiazol-2-yl]-N-[(4-nitrobenzoyl)oxy]imidoformamide
ID: Reference6343
Other Names: Methanimidamide, N'-[4-(3-chloro-4-methylphenyl)-5-methyl-2-thiazolyl]-N-[(4-nitrobenzoyl)oxy]-
Formula: C19H15ClN4O4S
N-[4-(3-Chloro-4-methylphenyl)-5-methyl-1,3-thiazol-2-yl]-N'-[(4-nitrobenzoyl)oxy]iminoformamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 120 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/24/2017 7:57:06 AM |
| InChI | InChI=1S/C19H15ClN4O4S/c1-11-3-4-14(9-16(11)20)17-12(2)29-19(23-17)21-10-22-28-18(25)13-5-7-15(8-6-13)24(26)27/h3-10H,1-2H3,(H,21,22,23) |
| InChI Key | SXKGJVNKFAPMSV-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | Methanimidamide, N'-[4-(3-chloro-4-methylphenyl)-5-methyl-2-thiazolyl]-N-[(4-nitrobenzoyl)oxy]- |