Systematic / IUPAC Name: 4-Methoxy-N-(3-pyridinyl)benzamide
ID: Reference6345
Other Names: 4-Methoxy-N-(pyridin-3-yl)benzamide
Formula: C13H12N2O2
4-Methoxy-N-pyridin-3-ylbenzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/24/2017 8:14:43 AM |
| InChI | InChI=1S/C13H12N2O2/c1-17-12-6-4-10(5-7-12)13(16)15-11-3-2-8-14-9-11/h2-9H,1H3,(H,15,16) |
| InChI Key | UZFNEWHJUPYYSZ-UHFFFAOYSA-N |
| Canonical SMILES | COC1=CC=C(C=C1)C(=O)NC2=CN=CC=C2 |
| CAS | |
| Splash | |
| Other Names | 4-Methoxy-N-(pyridin-3-yl)benzamide |
| PubChem | 327121 |
| ChEMBL | CHEMBL1328010 |
| ChemSpider | 289687 |