Systematic / IUPAC Name: 4-[3-(2-Furoylamino)butyl]-2-methoxyphenyl 2-furoate
ID: Reference6352
Other Names: 2-Furancarboxylic acid, 4-{3-[(2-furanylcarbonyl)amino]butyl}-2-methoxyphenyl ester
Formula: C21H21NO6
4-{3-[(2-Furylcarbonyl)amino]butyl}-2-methoxyphenyl 2-furoate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/24/2017 12:00:49 PM |
| InChI | InChI=1S/C21H21NO6/c1-14(22-20(23)17-5-3-11-26-17)7-8-15-9-10-16(19(13-15)25-2)28-21(24)18-6-4-12-27-18/h3-6,9-14H,7-8H2,1-2H3,(H,22,23) |
| InChI Key | DAJHWCFJZKGXPL-UHFFFAOYSA-N |
| Canonical SMILES | CC(CCC1=CC(=C(C=C1)OC(=O)C2=CC=CO2)OC)NC(=O)C3=CC=CO3 |
| CAS | |
| Splash | |
| Other Names | 2-Furancarboxylic acid, 4-{3-[(2-furanylcarbonyl)amino]butyl}-2-methoxyphenyl ester |