Systematic / IUPAC Name: 2,6-Difluorophenyl (2,6-dimethoxybenzoyl)carbamate
ID: Reference6361
Other Names: Carbamic acid, N-(2,6-dimethoxybenzoyl), 2,6-difluorophenyl ester
Formula: C16H13F2NO5
2,6-Difluorophenyl N-(2,6-dimethoxybenzoyl)carbamate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/24/2017 1:17:42 PM |
| InChI | InChI=1S/C16H13F2NO5/c1-22-11-7-4-8-12(23-2)13(11)15(20)19-16(21)24-14-9(17)5-3-6-10(14)18/h3-8H,1-2H3,(H,19,20,21) |
| InChI Key | HVRLBGXRJSJKOV-UHFFFAOYSA-N |
| Canonical SMILES | COC1=C(C(=CC=C1)OC)C(=O)NC(=O)OC2=C(C=CC=C2F)F |
| CAS | |
| Splash | |
| Other Names | Carbamic acid, N-(2,6-dimethoxybenzoyl), 2,6-difluorophenyl ester |
| PubChem | 2800104 |
| ChemSpider | 2078839 |
| ChEMBL | CHEMBL1311935 |