Systematic / IUPAC Name: 2-[4-(1,3-Dithiolan-2-yl)phenoxy]-N'-[(isopropylcarbamoyl)oxy]ethanimidamide
ID: Reference6372
Other Names:
(E)-{1-Amino-2-[4-(1,3-dithiolan-2-yl)phenoxy]ethylidene}amino N-(propan-2-yl)carbamate;
Ethanimidamide, 2-[4-(1,3-dithiolan-2-yl)phenoxy]-N'-({[(1-methylethyl)amino]carbonyl}oxy)-
Formula: C15H21N3O3S2
2-[4-(1,3-Dithiolan-2-yl)phenoxy]-N'-{[(isopropylamino)carbonyl]oxy}ethanimidamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/27/2017 10:57:00 AM |
| InChI | InChI=1S/C15H21N3O3S2/c1-10(2)17-15(19)21-18-13(16)9-20-12-5-3-11(4-6-12)14-22-7-8-23-14/h3-6,10,14H,7-9H2,1-2H3,(H2,16,18)(H,17,19) |
| InChI Key | MTKZXHJITDFTAY-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)NC(=O)ON=C(COC1=CC=C(C=C1)C2SCCS2)N |
| CAS | |
| Splash | |
| Other Names |
(E)-{1-Amino-2-[4-(1,3-dithiolan-2-yl)phenoxy]ethylidene}amino N-(propan-2-yl)carbamate; Ethanimidamide, 2-[4-(1,3-dithiolan-2-yl)phenoxy]-N'-({[(1-methylethyl)amino]carbonyl}oxy)- |