Systematic / IUPAC Name: N-{4-Methyl-1-oxo-1-[(2E)-2-(2-thienylmethylene)hydrazino]-2-pentanyl}-2-(3-thienyl)acetamide
ID: Reference6373
Other Names: 4-Methyl-2-[(2-thiophen-3-ylacetyl)amino]-N-(thiophen-2-ylmethylideneamino)pentanamide
Formula: C17H21N3O2S2
N-(3-Methyl-1-{[2-(2-thienylmethylene)hydrazino]carbonyl}butyl)-2-(3-thienyl)acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/27/2017 11:06:58 AM |
| InChI | InChI=1S/C17H21N3O2S2/c1-12(2)8-15(19-16(21)9-13-5-7-23-11-13)17(22)20-18-10-14-4-3-6-24-14/h3-7,10-12,15H,8-9H2,1-2H3,(H,19,21)(H,20,22)/b18-10+ |
| InChI Key | YQUDOEQOHQKSIP-VCHYOVAHSA-N |
| Canonical SMILES | CC(C)CC(C(=O)NN=CC1=CC=CS1)NC(=O)CC2=CSC=C2 |
| CAS | |
| Splash | |
| Other Names | 4-Methyl-2-[(2-thiophen-3-ylacetyl)amino]-N-(thiophen-2-ylmethylideneamino)pentanamide |