Systematic / IUPAC Name: 5'-Nitro-3,6-dihydro-2H-1,2'-bipyridine
ID: Reference6377
Other Names: 1(2H),2'-Bipyridine, 3,6-dihydro-5'-nitro-
Formula: C10H11N3O2
5-Nitro-2-(1,2,3,6-tetrahydropyridin-1-yl)pyridine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/27/2017 12:04:18 PM |
| InChI | InChI=1S/C10H11N3O2/c14-13(15)9-4-5-10(11-8-9)12-6-2-1-3-7-12/h1-2,4-5,8H,3,6-7H2 |
| InChI Key | HPZNZWNXRPQLTI-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | 1(2H),2'-Bipyridine, 3,6-dihydro-5'-nitro- |