Systematic / IUPAC Name: 1-(3-Bicyclo[2.2.1]heptanyl)-3-(cyclopentylideneamino)thiourea
ID: Reference6384
Other Names: Hydrazinecarbothioamide, N-bicyclo[2.2.1]hept-2-yl-2-cyclopentylidene-
Formula: C13H21N3S
N1-Bicyclo[2.2.1]hept-2-yl-2-cyclopentylidenhydrazine-1-carbothioamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/27/2017 3:30:49 PM |
| InChI | InChI=1S/C13H21N3S/c17-13(16-15-11-3-1-2-4-11)14-12-8-9-5-6-10(12)7-9/h9-10,12H,1-8H2,(H2,14,16,17) |
| InChI Key | UPZWJFLMKGBIJW-UHFFFAOYSA-N |
| Canonical SMILES | C1CCC(=NNC(=S)NC2CC3CCC2C3)C1 |
| CAS | |
| Splash | |
| Other Names | Hydrazinecarbothioamide, N-bicyclo[2.2.1]hept-2-yl-2-cyclopentylidene- |