Systematic / IUPAC Name: [4-(5-Anilino-1,2,4-thiadiazol-3-yl)-3-methyl-1H-pyrazol-1-yl](phenyl)methanone
ID: Reference6388
Other Names: Methanone, {3-methyl-4-[5-(phenylamino)-1,2,4-thiadiazol-3-yl]-1H-pyrazol-1-yl}phenyl-
Formula: C19H15N5OS
[4-(5-Anilino-1,2,4-thiadiazol-3-yl)-3-methyl-1H-pyrazol-1-yl](phenyl)methanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/28/2017 8:09:04 AM |
| InChI | InChI=1S/C19H15N5OS/c1-13-16(12-24(22-13)18(25)14-8-4-2-5-9-14)17-21-19(26-23-17)20-15-10-6-3-7-11-15/h2-12H,1H3,(H,20,21,23) |
| InChI Key | BBDYSHGQPWDWTK-UHFFFAOYSA-N |
| Canonical SMILES | CC1=NN(C=C1C2=NSC(=N2)NC3=CC=CC=C3)C(=O)C4=CC=CC=C4 |
| CAS | |
| Splash | |
| Other Names | Methanone, {3-methyl-4-[5-(phenylamino)-1,2,4-thiadiazol-3-yl]-1H-pyrazol-1-yl}phenyl- |