Systematic / IUPAC Name: 2,5-Dimethoxy-N-[(5-methyl-2-phenyl-2H-1,2,3-triazol-4-yl)methyl]benzenesulfonamide
ID: Reference6396
Other Names: Benzenesulfonamide, 2,5-dimethoxy-N-[(5-methyl-2-phenyl-2H-1,2,3-triazol-4-yl)methyl]-
Formula: C18H20N4O4S
2,5-Dimethoxy-N-[(5-methyl-2-phenyl-2H-1,2,3-triazol-4-yl)methyl]benzenesulfonamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/28/2017 10:52:56 AM |
| InChI | InChI=1S/C18H20N4O4S/c1-13-16(21-22(20-13)14-7-5-4-6-8-14)12-19-27(23,24)18-11-15(25-2)9-10-17(18)26-3/h4-11,19H,12H2,1-3H3 |
| InChI Key | QUKJPHSTGQGXHG-UHFFFAOYSA-N |
| Canonical SMILES | CC1=NN(N=C1CNS(=O)(=O)C2=C(C=CC(=C2)OC)OC)C3=CC=CC=C3 |
| CAS | |
| Splash | |
| Other Names | Benzenesulfonamide, 2,5-dimethoxy-N-[(5-methyl-2-phenyl-2H-1,2,3-triazol-4-yl)methyl]- |