Systematic / IUPAC Name: 2-Methyl-2-propanyl 4-({[(2,5-dimethyl-3-furyl)sulfonyl]amino}methyl)-1-piperidinecarboxylate
ID: Reference6399
Other Names: 1-Piperidinecarboxylic acid, 4-({[(2,5-dimethyl-3-furanyl)sulfonyl]amino}methyl)-, 1,1-dimethylethyl ester
Formula: C17H28N2O5S
tert-Butyl 4-({[(2,5-dimethyl-3-furyl)sulfonyl]amino}methyl)tetrahydro-1(2H)-pyridinecarboxylate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 96 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/28/2017 2:27:22 PM |
| InChI | InChI=1S/C17H28N2O5S/c1-12-10-15(13(2)23-12)25(21,22)18-11-14-6-8-19(9-7-14)16(20)24-17(3,4)5/h10,14,18H,6-9,11H2,1-5H3 |
| InChI Key | LJIIYQVNXGUKNZ-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC(=C(O1)C)S(=O)(=O)NCC2CCN(CC2)C(=O)OC(C)(C)C |
| CAS | |
| Splash | |
| Other Names | 1-Piperidinecarboxylic acid, 4-({[(2,5-dimethyl-3-furanyl)sulfonyl]amino}methyl)-, 1,1-dimethylethyl ester |