Systematic / IUPAC Name: (2,2-Dimethyl-2,3-dihydro-1-benzofuran-7-yl)[4-(diphenylmethyl)-1-piperazinyl]methanone
ID: Reference6404
Other Names: Methanone, (2,3-dihydro-2,2-dimethyl-7-benzofuranyl)[4-(diphenylmethyl)-1-piperazinyl]-
Formula: C28H30N2O2
(4-Benzhydrylpiperazino)(2,2-dimethyl-2,3-dihydro-1-benzofuran-7-yl)methanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/1/2017 7:49:22 AM |
| InChI | InChI=1S/C28H30N2O2/c1-28(2)20-23-14-9-15-24(26(23)32-28)27(31)30-18-16-29(17-19-30)25(21-10-5-3-6-11-21)22-12-7-4-8-13-22/h3-15,25H,16-20H2,1-2H3 |
| InChI Key | BGAGKZRPSDCCIT-UHFFFAOYSA-N |
| Canonical SMILES | CC1(CC2=CC=CC(=C2O1)C(=O)N3CCN(CC3)C(C4=CC=CC=C4)C5=CC=CC=C5)C |
| CAS | |
| Splash | |
| Other Names | Methanone, (2,3-dihydro-2,2-dimethyl-7-benzofuranyl)[4-(diphenylmethyl)-1-piperazinyl]- |