Systematic / IUPAC Name: 2-Fluoro-N-[3-(methylsulfanyl)phenyl]benzamide
ID: Reference6409
Other Names: Benzamide, 2-fluoro-N-[3-(methylthio)phenyl]-
Formula: C14H12FNOS
2-Fluoro-N-[3-(methylthio)phenyl]benzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/1/2017 11:46:43 AM |
| InChI | InChI=1S/C14H12FNOS/c1-18-11-6-4-5-10(9-11)16-14(17)12-7-2-3-8-13(12)15/h2-9H,1H3,(H,16,17) |
| InChI Key | YKZUIUXVMLULGI-UHFFFAOYSA-N |
| Canonical SMILES | CSC1=CC=CC(=C1)NC(=O)C2=CC=CC=C2F |
| CAS | |
| Splash | |
| Other Names | Benzamide, 2-fluoro-N-[3-(methylthio)phenyl]- |