Systematic / IUPAC Name: 2-(1-Benzofuran-2-yl)-3-(4-fluorophenyl)-1,3-thiazolidin-4-one
ID: Reference6410
Other Names: 4-Thiazolidinone, 2-(2-benzofuranyl)-3-(4-fluorophenyl)-
Formula: C17H12FNO2S
2-Benzo[b]furan-2-yl-3-(4-fluorophenyl)-1,3-thiazolan-4-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/1/2017 1:42:13 PM |
| InChI | InChI=1S/C17H12FNO2S/c18-12-5-7-13(8-6-12)19-16(20)10-22-17(19)15-9-11-3-1-2-4-14(11)21-15/h1-9,17H,10H2 |
| InChI Key | CRTOVTIUNCRWLE-UHFFFAOYSA-N |
| Canonical SMILES | C1C(=O)N(C(S1)C2=CC3=CC=CC=C3O2)C4=CC=C(C=C4)F |
| CAS | |
| Splash | |
| Other Names | 4-Thiazolidinone, 2-(2-benzofuranyl)-3-(4-fluorophenyl)- |