Systematic / IUPAC Name: N-{2-[(2-Chloro-6-fluorobenzyl)sulfanyl]ethyl}acetamide
ID: Reference6412
Other Names: Acetamide, N-(2-{[(2-chloro-6-fluorophenyl)methyl]thio}ethyl)-
Formula: C11H13ClFNOS
N1-{2-[(2-Chloro-6-fluorobenzyl)thio]ethyl}acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/1/2017 1:38:46 PM |
| InChI | InChI=1S/C11H13ClFNOS/c1-8(15)14-5-6-16-7-9-10(12)3-2-4-11(9)13/h2-4H,5-7H2,1H3,(H,14,15) |
| InChI Key | VPBVXXZJXQQZHN-UHFFFAOYSA-N |
| Canonical SMILES | CC(=O)NCCSCC1=C(C=CC=C1Cl)F |
| CAS | |
| Splash | |
| Other Names | Acetamide, N-(2-{[(2-chloro-6-fluorophenyl)methyl]thio}ethyl)- |