Systematic / IUPAC Name: 2-[(2,4-Dinitrophenyl)sulfanyl]-4-(3-pyridinyl)pyrimidine
ID: Reference6415
Other Names: Pyrimidine, 2-[(2,4-dinitrophenyl)thio]-4-(3-pyridinyl)-
Formula: C15H9N5O4S
2-[(2,4-Dinitrophenyl)thio]-4-(3-pyridyl)pyrimidine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/2/2017 8:07:31 AM |
| InChI | InChI=1S/C15H9N5O4S/c21-19(22)11-3-4-14(13(8-11)20(23)24)25-15-17-7-5-12(18-15)10-2-1-6-16-9-10/h1-9H |
| InChI Key | DAIIEXYBHRRDGT-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | Pyrimidine, 2-[(2,4-dinitrophenyl)thio]-4-(3-pyridinyl)- |