Systematic / IUPAC Name: (2E)-4-{[2-(Methoxycarbonyl)phenyl]amino}-4-oxo-2-butenoic acid
ID: Reference6417
Other Names:
(2E)-4-{[2-(Methoxycarbonyl)phenyl]amino}-4-oxobut-2-enoic acid;
4-{[2-(Methoxycarbonyl)phenyl]amino}-4-oxobut-2-enoic acid ;
Benzoic acid, 2-{[(2E)-3-carboxy-1-oxo-2-propen-1-yl]amino}-, 1-methyl ester
Formula: C12H11NO5
4-[2-(Methoxycarbonyl)anilino]-4-oxobut-2-enoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/2/2017 8:16:22 AM |
| InChI | InChI=1S/C12H11NO5/c1-18-12(17)8-4-2-3-5-9(8)13-10(14)6-7-11(15)16/h2-7H,1H3,(H,13,14)(H,15,16)/b7-6+ |
| InChI Key | DAPLTIRLFKBRQA-VOTSOKGWSA-N |
| Canonical SMILES | COC(=O)C1=CC=CC=C1NC(=O)C=CC(=O)O |
| CAS | |
| Splash | |
| Other Names |
(2E)-4-{[2-(Methoxycarbonyl)phenyl]amino}-4-oxobut-2-enoic acid; 4-{[2-(Methoxycarbonyl)phenyl]amino}-4-oxobut-2-enoic acid ; Benzoic acid, 2-{[(2E)-3-carboxy-1-oxo-2-propen-1-yl]amino}-, 1-methyl ester |
| ChemSpider | 618067 |
| PubChem | 708779 |
| ChEMBL | CHEMBL1501263 |