Systematic / IUPAC Name: 5-[3-(2-Chlorophenyl)-5-methyl-1,2-oxazol-4-yl]-1-[3-(trifluoromethyl)phenyl]-1H-tetrazole
ID: Reference6418
Other Names: Isoxazole, 3-(2-chlorophenyl)-5-methyl-4-{1-[3-(trifluoromethyl)phenyl]-1H-tetrazol-5-yl}-
Formula: C18H11ClF3N5O
5-[3-(2-Chlorophenyl)-5-methyl-4-isoxazolyl]-1-[3-(trifluoromethyl)phenyl]-1H-1,2,3,4-tetraazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/2/2017 8:20:18 AM |
| InChI | InChI=1S/C18H11ClF3N5O/c1-10-15(16(24-28-10)13-7-2-3-8-14(13)19)17-23-25-26-27(17)12-6-4-5-11(9-12)18(20,21)22/h2-9H,1H3 |
| InChI Key | IJWWPTXOOMMURO-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C(=NO1)C2=CC=CC=C2Cl)C3=NN=NN3C4=CC=CC(=C4)C(F)(F)F |
| CAS | |
| Splash | |
| Other Names | Isoxazole, 3-(2-chlorophenyl)-5-methyl-4-{1-[3-(trifluoromethyl)phenyl]-1H-tetrazol-5-yl}- |