Systematic / IUPAC Name: Dimethyl (2-fluoro-1,3-phenylene)biscarbamate
ID: Reference6429
Other Names: Carbamic acid, N,N'-(2-fluoro-1,3-phenylene)bis, dimethyl ester
Formula: C10H11FN2O4
Methyl N-{2-fluoro-3-[(methoxycarbonyl)amino]phenyl}carbamate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/2/2017 1:23:54 PM |
| InChI | InChI=1S/C10H11FN2O4/c1-16-9(14)12-6-4-3-5-7(8(6)11)13-10(15)17-2/h3-5H,1-2H3,(H,12,14)(H,13,15) |
| InChI Key | GWGUHKGNGCSCCT-UHFFFAOYSA-N |
| Canonical SMILES | COC(=O)NC1=C(C(=CC=C1)NC(=O)OC)F |
| CAS | |
| Splash | |
| Other Names | Carbamic acid, N,N'-(2-fluoro-1,3-phenylene)bis, dimethyl ester |