Systematic / IUPAC Name: N'-Carbamoyl-2-[(4-chlorophenyl)sulfanyl]-N-hydroxyethanimidamide
ID: Reference6435
Other Names: Ethanimidamide, N'-(aminocarbonyl)-2-[(4-chlorophenyl)thio]-N-hydroxy-
Formula: C9H10ClN3O2S
N-[2-[(4-Chlorophenyl)sulfanyl](hydroxy)ethanimidoyl]urea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/3/2017 6:52:32 AM |
| InChI | InChI=1S/C9H10ClN3O2S/c10-6-1-3-7(4-2-6)16-5-8(13-15)12-9(11)14/h1-4,15H,5H2,(H3,11,12,13,14) |
| InChI Key | PCZSUZFEQLWSJK-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=CC=C1SCC(=NC(=O)N)NO)Cl |
| CAS | |
| Splash | |
| Other Names | Ethanimidamide, N'-(aminocarbonyl)-2-[(4-chlorophenyl)thio]-N-hydroxy- |