Systematic / IUPAC Name: 4-(3-Nitrophenyl)-N,3-diphenyl-1,3-thiazol-2-imine
ID: Reference6439
Other Names: Benzenamine, N-[4-(3-nitrophenyl)-3-phenyl-2(3H)-thiazolylidene]-
Formula: C21H15N3O2S
N-[4-(3-Nitrophenyl)-3-phenyl-1,3-thiazol-2(3H)-ylidene]aniline mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/8/2017 1:06:10 PM |
| InChI | InChI=1S/C21H15N3O2S/c25-24(26)19-13-7-8-16(14-19)20-15-27-21(22-17-9-3-1-4-10-17)23(20)18-11-5-2-6-12-18/h1-15H |
| InChI Key | YWBDWXCPZAGHNJ-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)N=C2N(C(=CS2)C3=CC(=CC=C3)[N+](=O)[O-])C4=CC=CC=C4 |
| CAS | |
| Splash | |
| Other Names | Benzenamine, N-[4-(3-nitrophenyl)-3-phenyl-2(3H)-thiazolylidene]- |