Systematic / IUPAC Name: 1-{[5-(3-Methyl-4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl}piperidine
ID: Reference6442
Other Names: Piperidine, 1-{[5-(3-methyl-4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl}-
Formula: C15H18N4O3
2-(3-Methyl-4-nitrophenyl)-5-(piperidinomethyl)-1,3,4-oxadiazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/8/2017 1:22:47 PM |
| InChI | InChI=1S/C15H18N4O3/c1-11-9-12(5-6-13(11)19(20)21)15-17-16-14(22-15)10-18-7-3-2-4-8-18/h5-6,9H,2-4,7-8,10H2,1H3 |
| InChI Key | VBSVETDPJKYPCJ-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | Piperidine, 1-{[5-(3-methyl-4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl}- |