Systematic / IUPAC Name: 6,7-Dimethoxy-4-[(4-methylphenyl)sulfanyl]quinazoline
ID: Reference6454
Other Names:
6,7-Dimethoxy-4-(4-methylphenyl)sulfanylquinazoline;
Quinazoline, 6,7-dimethoxy-4-[(4-methylphenyl)thio]-
Formula: C17H16N2O2S
6,7-Dimethoxy-4-[(4-methylphenyl)thio]quinazoline mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/9/2017 12:08:06 PM |
| InChI | InChI=1S/C17H16N2O2S/c1-11-4-6-12(7-5-11)22-17-13-8-15(20-2)16(21-3)9-14(13)18-10-19-17/h4-10H,1-3H3 |
| InChI Key | QWSGISSWTYGSSD-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC=C(C=C1)SC2=NC=NC3=CC(=C(C=C32)OC)OC |
| CAS | |
| Splash | |
| Other Names |
6,7-Dimethoxy-4-(4-methylphenyl)sulfanylquinazoline; Quinazoline, 6,7-dimethoxy-4-[(4-methylphenyl)thio]- |
| ChemSpider | 2087259 |
| PubChem | 2808828 |
| ChEMBL | CHEMBL1724077 |