Systematic / IUPAC Name: N-[3-Chloro-5-(trifluoromethyl)-2-pyridinyl]-N'-(2-quinoxalinyl)-1,2-ethanediamine
ID: Reference6455
Other Names: 1,2-Ethanediamine, N1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N2-2-quinoxalinyl-
Formula: C16H13ClF3N5
N1-[3-Chloro-5-(trifluoromethyl)-2-pyridyl]-N2-quinoxalin-2-ylethane-1,2-diamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/10/2017 7:41:50 AM |
| InChI | InChI=1S/C16H13ClF3N5/c17-11-7-10(16(18,19)20)8-24-15(11)22-6-5-21-14-9-23-12-3-1-2-4-13(12)25-14/h1-4,7-9H,5-6H2,(H,21,25)(H,22,24) |
| InChI Key | JIMZQEWETCCYGN-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C2C(=C1)N=CC(=N2)NCCNC3=C(C=C(C=N3)C(F)(F)F)Cl |
| CAS | |
| Splash | |
| Other Names | 1,2-Ethanediamine, N1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N2-2-quinoxalinyl- |