Systematic / IUPAC Name: 1-[(2-Aminophenyl)sulfanyl]-3-(1H-indol-1-yl)-2-propanol
ID: Reference6459
Other Names: 1H-Indole-1-ethanol, α-{[(2-aminophenyl)thio]methyl}-
Formula: C17H18N2OS
1-[(2-Aminophenyl)thio]-3-(1H-indol-1-yl)propan-2-ol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/10/2017 9:01:33 AM |
| InChI | InChI=1S/C17H18N2OS/c18-15-6-2-4-8-17(15)21-12-14(20)11-19-10-9-13-5-1-3-7-16(13)19/h1-10,14,20H,11-12,18H2 |
| InChI Key | JWBDZYWSSBZJLM-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C2C(=C1)C=CN2CC(CSC3=CC=CC=C3N)O |
| CAS | |
| Splash | |
| Other Names | 1H-Indole-1-ethanol, α-{[(2-aminophenyl)thio]methyl}- |
| ChemSpider | 2087666 |
| ChEMBL | CHEMBL1417874 |
| PubChem | 2809241 |