Systematic / IUPAC Name: 1-Bicyclo[2.2.1]hept-2-yl-3-[2-(2-pyridinyl)ethyl]thiourea
ID: Reference6460
Other Names: Thiourea, N-bicyclo[2.2.1]hept-2-yl-N'-[2-(2-pyridinyl)ethyl]-
Formula: C15H21N3S
N-Bicyclo[2.2.1]hept-2-yl-N'-[2-(2-pyridyl)ethyl]thiourea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/10/2017 10:03:53 AM |
| InChI | InChI=1S/C15H21N3S/c19-15(17-8-6-13-3-1-2-7-16-13)18-14-10-11-4-5-12(14)9-11/h1-3,7,11-12,14H,4-6,8-10H2,(H2,17,18,19) |
| InChI Key | OUSKFHAFKTWQAS-UHFFFAOYSA-N |
| Canonical SMILES | C1CC2CC1CC2NC(=S)NCCC3=CC=CC=N3 |
| CAS | |
| Splash | |
| Other Names | Thiourea, N-bicyclo[2.2.1]hept-2-yl-N'-[2-(2-pyridinyl)ethyl]- |
| ChEMBL | CHEMBL1568589 |
| PubChem | 2809353 |
| ChemSpider | 2087775 |