Systematic / IUPAC Name: 1-(1-Benzothiophen-3-yl)-3-[(1,3,5-trimethyl-1H-pyrazol-4-yl)methyl]urea
ID: Reference6475
Other Names: Urea, N-benzo[b]thien-3-yl-N'-[(1,3,5-trimethyl-1H-pyrazol-4-yl)methyl]-
Formula: C16H18N4OS
N-(1-Benzothiophen-3-yl)-N'-[(1,3,5-trimethyl-1H-pyrazol-4-yl)methyl]urea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/16/2017 11:44:34 AM |
| InChI | InChI=1S/C16H18N4OS/c1-10-13(11(2)20(3)19-10)8-17-16(21)18-14-9-22-15-7-5-4-6-12(14)15/h4-7,9H,8H2,1-3H3,(H2,17,18,21) |
| InChI Key | WFZPGUUTCBHGNJ-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C(=NN1C)C)CNC(=O)NC2=CSC3=CC=CC=C32 |
| CAS | |
| Splash | |
| Other Names | Urea, N-benzo[b]thien-3-yl-N'-[(1,3,5-trimethyl-1H-pyrazol-4-yl)methyl]- |