Systematic / IUPAC Name: 1-Benzyl-8-(4-chloro-3-methylphenoxy)-3,7-dimethyl-3,7-dihydro-1H-purine-2,6-dione
ID: Reference6476
Other Names: 1H-Purine-2,6-dione, 8-(4-chloro-3-methylphenoxy)-3,7-dihydro-3,7-dimethyl-1-(phenylmethyl)-
Formula: C21H19ClN4O3
1-Benzyl-8-(4-chloro-3-methylphenoxy)-3,7-dimethyl-3,7-dihydro-1H-purine-2,6-dione mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/16/2017 11:49:28 AM |
| InChI | InChI=1S/C21H19ClN4O3/c1-13-11-15(9-10-16(13)22)29-20-23-18-17(24(20)2)19(27)26(21(28)25(18)3)12-14-7-5-4-6-8-14/h4-11H,12H2,1-3H3 |
| InChI Key | QXRWTWJCCYVUIH-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C=CC(=C1)OC2=NC3=C(N2C)C(=O)N(C(=O)N3C)CC4=CC=CC=C4)Cl |
| CAS | |
| Splash | |
| Other Names | 1H-Purine-2,6-dione, 8-(4-chloro-3-methylphenoxy)-3,7-dihydro-3,7-dimethyl-1-(phenylmethyl)- |