Systematic / IUPAC Name: 5-Oxo-3-phenyl-5-[(4-sulfamoylphenyl)amino]pentanoic acid
ID: Reference6484
Other Names:
3-Phenyl-4-[(4-sulfamoylphenyl)carbamoyl]butanoic acid;
Benzenepropanoic acid, β-(2-{[4-(aminosulfonyl)phenyl]amino}-2-oxoethyl)-
Formula: C17H18N2O5S
5-[4-(Aminosulfonyl)anilino]-5-oxo-3-phenylpentanoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/17/2017 1:20:29 PM |
| InChI | InChI=1S/C17H18N2O5S/c18-25(23,24)15-8-6-14(7-9-15)19-16(20)10-13(11-17(21)22)12-4-2-1-3-5-12/h1-9,13H,10-11H2,(H,19,20)(H,21,22)(H2,18,23,24) |
| InChI Key | LBDKPGOMIVLKLD-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)C(CC(=O)NC2=CC=C(C=C2)S(=O)(=O)N)CC(=O)O |
| CAS | |
| Splash | |
| Other Names |
3-Phenyl-4-[(4-sulfamoylphenyl)carbamoyl]butanoic acid; Benzenepropanoic acid, β-(2-{[4-(aminosulfonyl)phenyl]amino}-2-oxoethyl)- |